CAS 243990-53-6

[4-(benzyloxy)-3-methoxyphenyl]boronic acid

Description:

[4-(Benzyloxy)-3-methoxyphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with both a benzyloxy group and a methoxy group, contributing to its unique electronic and steric properties. The presence of these substituents can enhance the compound's solubility and reactivity. Typically, boronic acids like this one are utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in drug development. Its structural characteristics, including the arrangement of substituents and the boronic acid moiety, play a crucial role in its reactivity and potential applications in various fields of chemistry and materials science.

Formula: C₁₄H₁₅BO₄

InChI: InChI=1/C14H15BO4/c1-18-14-9-12(15(16)17)7-8-13(14)19-10-11-5-3-2-4-6-11/h2-9,16-17H,10H2,1H3

SMILES: COc1cc(ccc1OCc1ccccc1)B(O)O

Synonyms:

• Boronic acid, B-[3-methoxy-4-(phenylmethoxy)phenyl]-
• [4-(Benzyloxy)-3-methoxyphenyl]boronic acid

4-Benzyloxy-3-methoxybenzeneboronic acid

CAS: 243990-53-6

Formula: C₁₄H₁₅BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 258.0775

Ref: IN-DA00BDT4

4-(Benzyloxy)-3-methoxybenzeneboronic acid

CAS: 243990-53-6

4-(Benzyloxy)-3-methoxybenzeneboronic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 258.08g/mol

Ref: 54-OR3484

(4-(Benzyloxy)-3-methoxyphenyl)boronic acid

CAS: 243990-53-6

Formula: C₁₄H₁₅BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 258.08

Ref: 10-F228687