CAS 244-76-8
:9H-Pyrido[2,3-b]indole
Description:
9H-Pyrido[2,3-b]indole, with the CAS number 244-76-8, is a heterocyclic organic compound that features a fused bicyclic structure comprising a pyridine and an indole moiety. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. It typically exhibits a pale yellow to brownish color in solid form and is soluble in organic solvents. The presence of nitrogen atoms in its structure imparts basic properties, allowing it to participate in various chemical reactions, including electrophilic substitutions. 9H-Pyrido[2,3-b]indole has garnered interest in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. Its unique structure allows for interactions with biological targets, making it a subject of research in drug development. Additionally, it may serve as a building block in the synthesis of more complex organic compounds. As with many heterocycles, its properties can be influenced by substituents and the surrounding chemical environment, making it a versatile compound in organic synthesis and pharmaceutical applications.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-7H,(H,12,13)
InChI key:InChIKey=BPMFPOGUJAAYHL-UHFFFAOYSA-N
SMILES:C1=2C=3C(NC1=CC=CC2)=NC=CC3
Synonyms:- 1,9-Diazafluorene
- 1-Azacarbazole
- 1H-Pyrido(2,3-b)indole (8CI)(9CI)
- 1H-Pyrido[2,3-b]indole
- 9H-1,9-Diazafluorene
- 9H-pyrido[2,3-b]indole
- N-α-Carboline
- Nsc 67064
- alpha-Carboline
- α-Carboline
- a-carboline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
9H-Pyrido[2,3-b]indole
CAS:Formula:C11H8N2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:168.209H-Pyrido[2,3-b]indole
CAS:9H-Pyrido[2,3-b]indole is a fused heterocyclic compound widely used in biochemical experiments and drug synthesis research.
Formula:C11H8N2Purity:99.02%Color and Shape:SolidMolecular weight:168.2a-Carboline
CAS:a-Carboline is an organic molecule that has been shown to have a variety of biological effects. It is reactive, has photophysical properties, and can form stable complexes with water vapor. Studies have shown that a-carboline can be used as a substrate molecule for the transfer reactions of proton and hydrogen bonding interactions. It has been shown to have tissue culture activity in inflammatory bowel disease and autoimmune diseases. In addition, it can create stable complexes with hydroxyl groups and water vapor.Formula:C11H8N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:168.19 g/molTriazoxide
CAS:Controlled ProductApplications A carcinogenic compound formed during cooking processes
References Zhang, Y.P., et al.: Environ. Mol. Mutagen., 21, 100 (1993), Magdo, I., et al.: Cancer Lett., 81, 201 (1994),Formula:C11H8N2Color and Shape:NeatMolecular weight:168.19






