CAS 244022-71-7
:3-(Difluoromethoxy)benzylamine
Description:
3-(Difluoromethoxy)benzylamine is an organic compound characterized by the presence of a benzylamine structure substituted with a difluoromethoxy group at the meta position of the benzene ring. The difluoromethoxy group consists of a methoxy (-OCH3) moiety where two hydrogen atoms are replaced by fluorine atoms, enhancing the compound's reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the amine functional group, which can engage in hydrogen bonding. The presence of fluorine atoms often imparts unique electronic properties, making this compound of interest in medicinal chemistry and material science. Its CAS number, 244022-71-7, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as fluorinated compounds can have specific hazards associated with them.
Formula:C8H9F2NO
InChI:InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-2-6(4-7)5-11/h1-4,8H,5,11H2
SMILES:c1cc(cc(c1)OC(F)F)CN
Synonyms:- 1-[3-(Difluoromethoxy)phenyl]methanamine
- Benzenemethanamine, 3-(difluoromethoxy)-
- Z1R Coyff
- 3-(Difluoromethoxy)benzyl amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenemethanamine, 3-(difluoromethoxy)- (9CI)
CAS:Formula:C8H9F2NOPurity:95%Color and Shape:LiquidMolecular weight:173.16003-(Difluoromethoxy)benzylamine
CAS:3-(Difluoromethoxy)benzylamineFormula:C8H9F2NOPurity:96%Color and Shape: clear. almost colourless liquidMolecular weight:173.16g/mol3-(Difluoromethoxy)benzylamine
CAS:Formula:C8H9F2NOPurity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:173.163-(Difluoromethoxy)benzyl amine
CAS:<p>3-(Difluoromethoxy)benzyl amine is a high-quality reagent that is used as an intermediate in the synthesis of complex compounds. 3-(Difluoromethoxy)benzyl amine is also a useful building block for the synthesis of speciality chemicals and research chemicals. This compound can be used as a versatile building block, which can be used to synthesize different functional groups. 3-(Difluoromethoxy)benzyl amine is soluble in many organic solvents and has a boiling point of 193 °C.</p>Formula:C8H9F2NOPurity:Min. 95%Molecular weight:173.16 g/mol3-(Difluoromethoxy)benzylamine
CAS:Formula:C8H9F2NOPurity:95%Color and Shape:Liquid, ClearMolecular weight:173.163




