
CAS 244022-74-0
:2-[3,5-bis(trifluoromethyl)phenyl]-N'-hydroxyethanimidamide
Description:
2-[3,5-bis(trifluoromethyl)phenyl]-N'-hydroxyethanimidamide is a chemical compound characterized by its unique structure, which includes a hydroxyethanimidamide moiety and a phenyl group substituted with two trifluoromethyl groups at the 3 and 5 positions. This substitution significantly enhances the compound's lipophilicity and alters its electronic properties, making it of interest in various chemical and biological applications. The presence of the hydroxy group contributes to its potential reactivity and solubility in polar solvents. The trifluoromethyl groups are known to impart unique characteristics, such as increased metabolic stability and altered binding interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its CAS number, 244022-74-0, allows for easy identification and retrieval of information related to its synthesis, properties, and potential applications in scientific literature. Overall, this compound exemplifies the interplay between molecular structure and function in the realm of organic chemistry.
Formula:C10H8F6N2O
InChI:InChI=1/C10H8F6N2O/c11-9(12,13)6-1-5(3-8(17)18-19)2-7(4-6)10(14,15)16/h1-2,4,19H,3H2,(H2,17,18)
SMILES:c1c(cc(cc1C(F)(F)F)C(F)(F)F)CC(=N)NO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-Bis(trifluoromethyl)phenylacetamidoxime
CAS:3,5-Bis(trifluoromethyl)phenylacetamidoximePurity:techMolecular weight:286.17g/mol
