CAS 244049-27-2
:4-amino-7-hydroxy-2H-chromen-2-one
Description:
4-Amino-7-hydroxy-2H-chromen-2-one, also known as a derivative of coumarin, is a chemical compound characterized by its chromenone structure, which features a benzopyrone core. This compound typically exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties, making it of interest in pharmaceutical research. The presence of amino and hydroxy functional groups enhances its reactivity and solubility in polar solvents. It is often studied for its potential applications in drug development and as a biochemical probe. The compound's molecular structure allows for various interactions with biological targets, contributing to its pharmacological effects. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-amino-7-hydroxy-2H-chromen-2-one represents a significant compound in the field of medicinal chemistry, with ongoing research aimed at elucidating its mechanisms of action and therapeutic potential.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c10-7-4-9(12)13-8-3-5(11)1-2-6(7)8/h1-4,11H,10H2
SMILES:c1cc2c(cc(=O)oc2cc1O)N
Synonyms:- 2H-1-Benzopyran-2-one, 4-amino-7-hydroxy-
- 4-Amino-7-hydroxy-2H-chromen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
