CAS 244081-42-3

Rafabegron

Description:

Rafabegron is a chemical compound classified as a selective beta-3 adrenergic receptor agonist. It is primarily investigated for its potential therapeutic applications in treating conditions such as overactive bladder by promoting relaxation of the bladder detrusor muscle, thereby enhancing urinary storage capacity. Rafabegron exhibits a specific affinity for beta-3 adrenergic receptors, which are predominantly found in adipose tissue and the bladder. The compound's mechanism of action involves the activation of these receptors, leading to increased lipolysis and improved bladder function. In terms of its chemical structure, Rafabegron features a distinct arrangement of functional groups that contribute to its biological activity and pharmacokinetic properties. The compound has undergone various preclinical and clinical studies to evaluate its efficacy and safety profile. As with many pharmacological agents, understanding its metabolism, potential side effects, and interactions with other medications is crucial for its therapeutic use. Overall, Rafabegron represents a promising avenue in the development of treatments for urinary disorders.

Formula: C₂₁H₂₃ClN₂O₄

InChI: InChI=1S/C21H23ClN2O4/c1-13(23-11-18(25)14-4-2-5-16(22)9-14)8-15-10-24-21-17(15)6-3-7-19(21)28-12-20(26)27/h2-7,9-10,13,18,23-25H,8,11-12H2,1H3,(H,26,27)/t13-,18+/m1/s1

InChI key: InChIKey=FHEYFIGWYQJVDR-ACJLOTCBSA-N

SMILES: O(CC(O)=O)C1=C2C(C(C[C@H](NC[C@H](O)C3=CC(Cl)=CC=C3)C)=CN2)=CC=C1

Synonyms:

• AJ 9677
• Acetic acid, 2-[[3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]oxy]-
• TAK 677
• Acetic acid, [[3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]oxy]-
• 2-[[3-[(2R)-2-[[(2R)-2-(3-Chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]oxy]acetic acid

Rafabegron

CAS: 244081-42-3

Rafabegron

Purity: ≥98%

Molecular weight: 402.87g/mol

Ref: 54-BUP00610

Rafabegron

CAS: 244081-42-3

Rafabegron (TAK677) is a potent and selective β3 adrenergic receptor agonist for the study of diabetes and obesity.

Formula: C₂₁H₂₃ClN₂O₄

Purity: 99.21%

Color and Shape: Solid

Molecular weight: 402.87

Ref: TM-T34256