CAS 244081-71-8

6-Chloro-2-(3-nitrophenyl)imidazo[1,2-b]pyridazine

Description:

6-Chloro-2-(3-nitrophenyl)imidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its imidazo[1,2-b]pyridazine core, which features a chlorine atom and a nitrophenyl substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, though its solubility in water is limited. The presence of the chlorine atom contributes to its reactivity, while the nitro group can influence its electronic properties and potential biological activity. This compound is of interest in medicinal chemistry and may exhibit pharmacological properties, making it a candidate for further research in drug development. Its structure allows for various interactions with biological targets, which can be explored through structure-activity relationship studies. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the reaction conditions. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₁₂H₇ClN₄O₂

InChI: InChI=1S/C12H7ClN4O2/c13-11-4-5-12-14-10(7-16(12)15-11)8-2-1-3-9(6-8)17(18)19/h1-7H

InChI key: InChIKey=GZWJARVERQGPGT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C2=CN3C(=N2)C=CC(Cl)=N3)C=CC1

Synonyms:

• Imidazo[1,2-b]pyridazine, 6-chloro-2-(3-nitrophenyl)-
• 6-Chloro-2-(3-nitrophenyl)imidazo[1,2-b]pyridazine

6-chloro-2-(3-nitrophenyl)imidazo[1,2-b]pyridazine

CAS: 244081-71-8

6-chloro-2-(3-nitrophenyl)imidazo[1,2-b]pyridazine

Purity: ≥95%

Molecular weight: 274.66g/mol

Ref: 54-OR21644