CAS 24410-19-3

3H-Pyrido[2,3-d]pyrimidin-4-one

Description:

3H-Pyrido[2,3-d]pyrimidin-4-one, with the CAS number 24410-19-3, is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound typically exhibits a planar configuration due to its aromatic nature, which contributes to its stability and potential biological activity. It is often recognized for its role in medicinal chemistry, particularly as a scaffold for the development of various pharmaceuticals. The presence of nitrogen atoms in the ring enhances its ability to participate in hydrogen bonding and coordination with metal ions, which can be crucial for its reactivity and interaction with biological targets. Additionally, 3H-Pyrido[2,3-d]pyrimidin-4-one may exhibit fluorescence properties, making it useful in certain analytical applications. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications in research and industry. Overall, this compound represents a significant interest in the fields of organic synthesis and drug discovery.

Formula: C₇H₅N₃O

InChI: InChI=1/C7H5N3O/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-4H,(H,8,9,10,11)

SMILES: c1cc2c(nc1)ncnc2O

Synonyms:

• 4-Hydroxypyrido (2,3-d)pyrimidine
• pyrido[2,3-d]pyrimidin-4(1H)-one
• 3H,4H-pyrido[2,3-d]pyrimidin-4-one

Pyrido[2,3-d]pyrimidin-4(1H)-one

CAS: 24410-19-3

Formula: C₇H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.1341

Ref: IN-DA00BCKS

3H,4H-Pyrido[2,3-d]pyrimidin-4-one

CAS: 24410-19-3

3H,4H-Pyrido[2,3-d]pyrimidin-4-one

Purity: 99%

Molecular weight: 147.13g/mol

Ref: 54-OR32695

Pyrido[2,3-d]pyrimidin-4(1H)-one

CAS: 24410-19-3

Formula: C₇H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 147.137

Ref: 10-F076372