CymitQuimica logo

CAS 24410-55-7

:

7-chloro-1-benzofuran

Description:
7-Chloro-1-benzofuran is an organic compound characterized by its fused benzene and furan rings, with a chlorine substituent at the 7-position of the benzofuran structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and potential reactivity. The presence of the chlorine atom introduces unique electronic and steric effects, influencing its chemical behavior and interactions. 7-Chloro-1-benzofuran may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility can vary based on the solvent used, and it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 7-chloro-1-benzofuran serves as a valuable compound in research and development within organic chemistry and related fields.
Formula:C8H5ClO
InChI:InChI=1/C8H5ClO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H
InChI key:AROWSPBDKGWJNQ-UHFFFAOYSA-N
SMILES:c1cc2ccoc2c(c1)Cl
Synonyms:
  • Benzofuran, 7-chloro-
  • 7-Chlorobenzofuran
  • 7-Chloro-1-benzofuran
Found 4 products.