CAS 24410-59-1: 5-Fluorobenzofuran

Description:5-Fluorobenzofuran is an organic compound characterized by a benzofuran structure with a fluorine atom substituted at the 5-position of the benzofuran ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the fluorine atom enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and drug development. 5-Fluorobenzofuran may exhibit various chemical behaviors, including electrophilic substitution reactions due to the electron-withdrawing nature of the fluorine atom. Additionally, it may participate in nucleophilic reactions, particularly in the presence of suitable reagents. Safety data should be consulted, as with any chemical substance, to understand its handling, storage, and potential hazards. Overall, 5-Fluorobenzofuran serves as a valuable building block in organic synthesis and pharmaceutical research.

Formula:C₈H₅FO

InChI:InChI=1S/C8H5FO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H

Synonyms:
Benzofuran, 5-fluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-Fluorobenzofuran REF: IN-DA006V9TCAS: 24410-59-1	95%	To inquire	Mon 05 May 25
5-Fluorobenzofuran REF: 10-F222798CAS: 24410-59-1	95.0%	45.00 €~357.00 €	Tue 06 May 25
5-Fluorobenzo[b]furan REF: 54-PC48599CAS: 24410-59-1	95%	99.00 €~1,141.00 €	Mon 12 May 25
5-Fluorobenzofuran REF: 3D-FF77201CAS: 24410-59-1	Min. 95%	- - -	Discontinued product