CymitQuimica logo

CAS 24410-61-5

:

Benzofuran, 7-fluoro-

Description:
Benzofuran, 7-fluoro- is an organic compound characterized by the presence of a benzofuran ring system with a fluorine atom substituted at the 7-position. This compound belongs to the class of heterocyclic aromatic compounds, which are known for their unique chemical properties due to the incorporation of heteroatoms in the ring structure. The presence of the fluorine atom can significantly influence the compound's reactivity, polarity, and biological activity. Benzofuran derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science. The compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and solubility characteristics can vary based on the substituents present, which can affect its behavior in different chemical environments. Overall, benzofuran, 7-fluoro- is a compound of interest in various fields due to its unique structural features and potential applications.
Formula:C8H5FO
InChI:InChI=1S/C8H5FO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H
InChI key:WPCSQSMSSNPKKB-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)F)OC=C2
Synonyms:
  • 7-Fluorobenzofuran
Found 4 products.