CAS 24410-84-2
:ethyl (2E)-pent-2-enoate
Description:
Ethyl (2E)-pent-2-enoate, also known as ethyl 2-pentenoate, is an organic compound characterized by its ester functional group, which is derived from pentenoic acid and ethanol. It features a double bond between the second and third carbon atoms in the pentene chain, giving it a cis/trans isomerism, with the "E" designation indicating the trans configuration. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it useful in flavoring and fragrance applications. Ethyl (2E)-pent-2-enoate is soluble in organic solvents and has limited solubility in water due to its hydrophobic alkyl chain. It is often utilized in organic synthesis and as an intermediate in the production of various chemicals. The compound's reactivity is influenced by the presence of the double bond, allowing it to participate in addition reactions, making it valuable in the synthesis of more complex organic molecules. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C7H12O2
InChI:InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h5-6H,3-4H2,1-2H3/b6-5+
Synonyms:- (E)-2-Pentenoic acid ethyl ester
- Ethyl 2-pentenoate
- Ethyl Pent-2-En-1-Oate
- Ethyl trans-2-pentenoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2E)-2-Pentenoic acid ethyl ester
CAS:Formula:C7H12O2Purity:95%Color and Shape:LiquidMolecular weight:128.1690Ethyl (2E)-pent-2-enoate
CAS:Ethyl (2E)-pent-2-enoateFormula:C7H12O2Purity:techColor and Shape: clear. lemon liquidMolecular weight:128.17g/mol


