CymitQuimica logo

CAS 244126-64-5

:

5-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid

Description:
5-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiophene core substituted with a trifluoromethyl group and a carboxylic acid functional group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The benzothiophene moiety contributes to its aromatic properties and potential applications in pharmaceuticals and agrochemicals. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its carboxylic acid group can participate in various chemical reactions, including esterification and amidation, making it versatile for further chemical modifications. Additionally, the trifluoromethyl group can impart unique electronic properties, which may enhance the compound's interaction with biological targets. Overall, 5-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid is of interest in synthetic chemistry and material science due to its distinctive structural features and potential applications.
Formula:C10H5F3O2S
InChI:InChI=1/C10H5F3O2S/c11-10(12,13)6-1-2-7-5(3-6)4-8(16-7)9(14)15/h1-4H,(H,14,15)
InChI key:ROIKYRUNAMGSHG-UHFFFAOYSA-N
SMILES:c1cc2c(cc1C(F)(F)F)cc(C(=O)O)s2
Synonyms:
  • Benzo[b]thiophene-2-carboxylic acid, 5-(trifluoromethyl)-
  • 5-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid
Found 4 products.