CAS 2442-61-7: (±)-1,2-Diolein
Description:(±)-1,2-Diolein, with the CAS number 2442-61-7, is a glycerol ester derived from oleic acid, characterized by its two oleic acid chains attached to a glycerol backbone. This compound is a type of diglyceride, specifically a diacylglycerol, and is known for its role in biological systems as a component of lipids. It is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. (±)-1,2-Diolein exhibits emulsifying properties, making it useful in food and cosmetic formulations. Additionally, it can serve as a substrate in various biochemical reactions and is involved in metabolic pathways. Its stereochemistry, indicated by the (±) notation, suggests that it exists as a racemic mixture of enantiomers, which may exhibit different biological activities. Overall, (±)-1,2-Diolein is significant in both industrial applications and biological research due to its structural and functional properties.
Formula:C39H72O5
InChI:InChI=1/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18-
InChI key:InChIKey=AFSHUZFNMVJNKX-CLFAGFIQNA-N
SMILES:O=C(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)CO)CCCCCCCC=CCCCCCCCC
- Synonyms:
- 9-Octadecenoic acid (Z)-, 1-(hydroxymethyl)-1,2-ethanediyl ester
- Olein, 1,2-di-
- 9-Octadecenoic acid (9Z)-, 1-(hydroxymethyl)-1,2-ethanediyl ester
- 9-Octadecenoic acid (9Z)-, 1,1′-[1-(hydroxymethyl)-1,2-ethanediyl] ester
- 1,2-Diolein
