CAS 24420-86-8

indole-3-acetic-alpha,alpha-D2 acid

Description:

Indole-3-acetic-alpha,alpha-D2 acid, with the CAS number 24420-86-8, is a deuterated form of indole-3-acetic acid (IAA), a naturally occurring plant hormone known as an auxin. This compound plays a crucial role in regulating various aspects of plant growth and development, including cell elongation, root formation, and responses to light and gravity. The deuteration (replacement of hydrogen atoms with deuterium) can enhance the stability and tracking of the compound in biochemical studies. Indole-3-acetic-alpha,alpha-D2 acid exhibits similar biological activity to its non-deuterated counterpart, making it useful in research to study auxin metabolism and transport in plants. Its chemical structure features an indole ring, which is characteristic of many biologically active compounds, and it is typically soluble in organic solvents. The presence of deuterium can also facilitate advanced analytical techniques, such as nuclear magnetic resonance (NMR) spectroscopy, allowing for detailed investigations into its interactions and mechanisms of action within plant systems.

Formula: C₁₀H₇D₂NO₂

InChI: InChI=1/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i5D2

SMILES: c1ccc2c(c1)c(C(C(=O)O)([2H])[2H])c[nH]2

Synonyms:

• 1H-indol-3-yl(2H2)acetic acid

Indole-3-acetic-α,α-d2Acid

CAS: 24420-86-8

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 177.20

Ref: 3U-D1709

Indole-3-Acetic-d2 Acid

Controlled Product

CAS: 24420-86-8

Applications Indole-3-Acetic-d2 Acid (cas# 24420-86-8) is a useful research chemical.

Formula: C₁₀₂H₂H₇NO₂

Color and Shape: Neat

Molecular weight: 177.20

Ref: TR-I708205