
CAS 244218-51-7
:N-(4-Amino-2-methylquinolin-6-yl)-2-(4-ethylphenoxymethyl)benzamide hydrochloride
Description:
N-(4-Amino-2-methylquinolin-6-yl)-2-(4-ethylphenoxymethyl)benzamide hydrochloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a benzamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as good solubility in polar solvents and potential biological activity. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. The ethylphenoxy group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous environments compared to its free base form. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the structural motifs that are often associated with bioactive compounds. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies.
Formula:C26H26ClN3O2
InChI:InChI=1/C26H25N3O2.ClH/c1-3-18-8-11-21(12-9-18)31-16-19-6-4-5-7-22(19)26(30)29-20-10-13-25-23(15-20)24(27)14-17(2)28-25;/h4-15H,3,16H2,1-2H3,(H2,27,28)(H,29,30);1H
SMILES:CCc1ccc(cc1)OCc1ccccc1C(=Nc1ccc2c(c1)c(cc(C)n2)N)O.Cl
Synonyms:- Jtc-801
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
JTC-801
CAS:JTC-801 is a selective opioid receptor-like1 (ORL1) receptor antagonist with IC50 of 94 nM, weakly inhibits receptors δ, κ, and μ.Formula:C26H25N3O2·HClPurity:99.27% - 99.59%Color and Shape:SolidMolecular weight:447.96JTC-801
CAS:JTC-801 is a selective agonist for the κ-opioid receptors and has been shown to inhibit the proliferation of tumor cells in vitro. It binds to κ-opioid receptors on the surface of cells and activates these receptors, which causes an increase in cytosolic calcium. This drug also inhibits the pro-apoptotic protein Bax, leading to apoptosis (cell death). JTC-801 has been shown to have a low toxicity profile in mice and does not cross the blood brain barrier. It also has been found to have a similar affinity for δ-opioid receptors as morphine and shows anti-inflammatory effects by inhibiting prostaglandin synthesis.
Formula:C26H25N3O2·HClPurity:Min. 95%Molecular weight:447.96 g/mol




