CAS 244221-04-3
:1-fluoro-4-(2-isocyanoethyl)benzene
Description:
1-Fluoro-4-(2-isocyanoethyl)benzene, with the CAS number 244221-04-3, is an organic compound characterized by the presence of a fluorine atom and an isocyanoethyl group attached to a benzene ring. The fluorine substitution at the para position of the benzene ring influences the compound's reactivity and polarity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The isocyanoethyl group introduces a functional group that can participate in further chemical transformations, such as forming coordination complexes or engaging in cycloaddition reactions. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its unique structure may confer interesting properties, such as enhanced solubility in organic solvents and potential applications in materials science or medicinal chemistry. However, detailed safety and handling information should be consulted, as compounds containing isocyanides can be toxic and require careful management in laboratory settings.
Formula:C9H8FN
InChI:InChI=1/C9H8FN/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5H,6-7H2
SMILES:[C-]#[N+]CCc1ccc(cc1)F
Synonyms:- 2-(4-Fluorophenyl)ethyl isocyanide
- Benzene, 1-fluoro-4-(2-isocyanoethyl)-
- 1-Fluoro-4-(2-isocyanoethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
