CAS 24423-98-1
:1-Chloro-3-hydroxy-2-propanone
Description:
1-Chloro-3-hydroxy-2-propanone, with the CAS number 24423-98-1, is an organic compound characterized by the presence of a chloro group and a hydroxyl group attached to a three-carbon backbone. This compound typically appears as a colorless to pale yellow liquid and is soluble in water due to the hydroxyl group, which can engage in hydrogen bonding. The chloro substituent introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the preparation of other chemical entities. Its molecular structure suggests it may exhibit both nucleophilic and electrophilic properties, allowing it to participate in various chemical reactions, such as substitution and addition reactions. The presence of both functional groups also indicates potential applications in pharmaceuticals and agrochemicals. However, safety precautions should be observed when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Overall, 1-Chloro-3-hydroxy-2-propanone is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C3H5ClO2
InChI:InChI=1S/C3H5ClO2/c4-1-3(6)2-5/h5H,1-2H2
InChI key:InChIKey=JWZYQAITGQPZNM-UHFFFAOYSA-N
SMILES:C(CCl)(CO)=O
Synonyms:- 1-Chloro-3-hydroxyacetone
- 3-Chloro-1-hydroxyacetone
- 1-Chloro-3-hydroxy-2-propanone
- 2-Propanone, 1-chloro-3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
