CAS 24425-52-3
:S-ethylglutathione
Description:
S-ethylglutathione is a derivative of glutathione, a tripeptide composed of glutamic acid, cysteine, and glycine, with an ethyl group substituting the hydrogen atom on the sulfur of the cysteine residue. This modification enhances its lipophilicity, allowing for improved cellular uptake and potential therapeutic applications. S-ethylglutathione is known for its antioxidant properties, helping to protect cells from oxidative stress by neutralizing free radicals and reactive oxygen species. It plays a role in detoxification processes, particularly in the liver, where it aids in the conjugation of harmful substances for excretion. Additionally, S-ethylglutathione may support cellular functions related to redox balance and immune response. Its stability and solubility in aqueous solutions make it suitable for various biochemical applications. As a research chemical, it is often studied for its potential benefits in health and disease management, particularly in conditions associated with oxidative damage. However, further studies are needed to fully understand its mechanisms and therapeutic potential.
Formula:C12H21N3O6S
InChI:InChI=1/C12H21N3O6S/c1-2-22-6-8(11(19)14-5-10(17)18)15-9(16)4-3-7(13)12(20)21/h7-8H,2-6,13H2,1H3,(H,14,19)(H,15,16)(H,17,18)(H,20,21)/t7-,8-/m0/s1
SMILES:CCSC[C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O
Synonyms:- S-Ethyl glutathione
- L-gamma-Glutamyl-S-ethyl-L-cysteinylglycine
- gamma-Glutamyl-L-cysteinylglycyl ethyl ester
- Glycine, L-gamma-glutamyl-S-ethyl-L-cysteinyl-
- Glycine, N-(S-ethyl-N-L-gamma-glutamyl-L-cysteinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
S-Ethylglutathione (>90%)
CAS:Controlled ProductApplications An inhibitor of the enzyme Glyoxalase 1.
References Vince, R. and Wadd, W.B.: Biochemical and Biophysical Res. Commun., 35, 5 (1969), Vegvari, A., et al.: ChemBioChem, 3(11), 1117 (2002)Formula:C12H21N3O6SPurity:>90%Color and Shape:NeatMolecular weight:335.38S-Ethyl glutathione
CAS:S-Ethyl glutathione is the enzyme Glyoxalase 1 inhibitor.Formula:C12H21N3O6SPurity:98%Color and Shape:SolidMolecular weight:335.38


