CAS 244255-92-3

(4-pyrimidin-2-ylpiperazin-1-yl)acetic acid

Description:

(4-pyrimidin-2-ylpiperazin-1-yl)acetic acid is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrimidine moiety. This compound typically exhibits properties associated with both basic and acidic functionalities due to the presence of the piperazine nitrogen atoms and the carboxylic acid group. It is often used in medicinal chemistry and drug development, particularly in the design of pharmaceuticals targeting various biological pathways. The compound may exhibit moderate solubility in polar solvents, and its stability can be influenced by pH and temperature. Additionally, it may possess biological activity, making it a candidate for further research in therapeutic applications. The presence of the pyrimidine ring suggests potential interactions with biological targets, such as receptors or enzymes, which can be explored in pharmacological studies. Overall, (4-pyrimidin-2-ylpiperazin-1-yl)acetic acid represents a versatile scaffold in the realm of organic and medicinal chemistry.

Formula: C₁₀H₁₄N₄O₂

InChI: InChI=1/C10H14N4O2/c15-9(16)8-13-4-6-14(7-5-13)10-11-2-1-3-12-10/h1-3H,4-8H2,(H,15,16)

SMILES: c1cnc(nc1)N1CCN(CC1)CC(=O)O

Synonyms:

• 1-Piperazineacetic Acid, 4-(2-Pyrimidinyl)-

(4-Pyrimidin-2-ylpiperazin-1-yl)acetic acid

CAS: 244255-92-3

Formula: C₁₀H₁₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.2438

Ref: IN-DA003G95

2-(4-(Pyrimidin-2-yl)piperazin-1-yl)acetic acid

CAS: 244255-92-3

2-(4-(Pyrimidin-2-yl)piperazin-1-yl)acetic acid

Purity: 95%

Ref: 54-OR1038969

[4-(2-pyrimidinyl)-1-piperazinyl]acetic acid

CAS: 244255-92-3

Formula: C₁₀H₁₄N₄O₂

Purity: 95%

Molecular weight: 222.248

Ref: 10-F310740