CAS 24435-27-6
:S-octylglutathione
Description:
S-octylglutathione is a synthetic derivative of glutathione, a tripeptide composed of glutamate, cysteine, and glycine, which plays a crucial role in cellular antioxidant defense and detoxification processes. This compound features an octyl group attached to the sulfur atom of the cysteine residue, enhancing its lipophilicity and membrane permeability compared to standard glutathione. S-octylglutathione is known for its potential applications in biochemistry and pharmacology, particularly in studies related to oxidative stress, cellular signaling, and drug delivery systems. Its ability to penetrate cell membranes makes it a valuable tool for investigating the roles of glutathione in various biological processes. Additionally, S-octylglutathione may exhibit protective effects against oxidative damage and could be explored for therapeutic applications in conditions associated with oxidative stress. As with many synthetic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C18H33N3O6S
InChI:InChI=1/C18H33N3O6S/c1-3-4-5-6-7-11(2)21(16(23)13(20)10-28)15(18(26)27)14(22)9-8-12(19)17(24)25/h11-13,15,28H,3-10,19-20H2,1-2H3,(H,24,25)(H,26,27)/t11?,12-,13-,15-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Amino-5-((1-((carboxymethyl)amino)-3-(octylthio)-1-oxopropan-2-yl)amino)-5-oxopentanoic acid
CAS:Formula:C18H33N3O6SMolecular weight:419.5361S-Octylglutathione
CAS:S-Octylglutathione is a competitive inhibitor of glutathione S-transferase (GST) [1].Formula:C18H33N3O6SColor and Shape:SolidMolecular weight:419.54

