CAS 2444-28-2
:2,6-Di-tert-butylhydroquinone
Description:
2,6-Di-tert-butylhydroquinone (CAS 2444-28-2) is an organic compound that belongs to the class of phenolic antioxidants. It is characterized by its two tert-butyl groups attached to the 2 and 6 positions of the hydroquinone structure, which enhances its stability and antioxidant properties. This compound is typically a white to off-white crystalline solid, exhibiting low solubility in water but good solubility in organic solvents. It is known for its ability to inhibit oxidative degradation of various materials, making it valuable in the food, cosmetic, and polymer industries as a stabilizer. Additionally, 2,6-Di-tert-butylhydroquinone has a relatively high melting point and is stable under normal conditions, although it can undergo oxidation when exposed to air or light. Its antioxidant activity is attributed to its ability to donate hydrogen atoms, thus neutralizing free radicals. Safety data indicates that while it is generally considered safe in regulated amounts, it should be handled with care to avoid potential irritation or adverse effects.
Formula:C14H22O2
InChI:InChI=1S/C14H22O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,15-16H,1-6H3
InChI key:InChIKey=JFGVTUJBHHZRAB-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(O)C(C(C)(C)C)=CC(O)=C1
Synonyms:- 1,4-Benzenediol, 2,6-bis(1,1-dimethylethyl)-
- 2,6-Di-tert-butyl-1,4-benzenediol
- 2,6-Bis(1,1-dimethylethyl)-1,4-benzenediol
- 2,6-Di-tert-butylhydroquinone
- 2,6-di-tert-butylbenzene-1,4-diol
- Hydroquinone, 2,6-di-tert-butyl-
- 2,6-Di-tert-butyl-hydroquinone
- 2,6-Di-tert-butylhydroquinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Bis(1,1-dimethylethyl)-1,4-benzenediol (Technical Grade)
CAS:Controlled ProductFormula:C14H22O2Color and Shape:NeatMolecular weight:222.3232,6-Di-tert-butylbenzene-1,4-diol
CAS:2,6-Di-tert-butylbenzene-1,4-diol is a phenoxy radical that can be used to study the kinetics of polymeric biomaterials. It has been used in manometric and kinetic studies of polymerization reactions. 2,6-Di-tert-butylbenzene-1,4-diol is an organic compound with a molecular weight of 170.2 g/mol and a chemical formula of C12H24O2. The compound is soluble in ethanol, ether and chloroform. Spectrophotometry has shown that 2,6-Di-tert-butylbenzene-1,4-diol absorbs light with wavelengths between 200 nm and 400 nm.
Formula:C14H22O2Purity:Min. 95%Color and Shape:PowderMolecular weight:222.32 g/mol




