CAS 24449-39-6

2,2,2',2'-tetramethyl-2H,2'H-5,5'-bibenzo[h]chromene-6,6'-diol

Description:

2,2,2',2'-Tetramethyl-2H,2'H-5,5'-bibenzo[h]chromene-6,6'-diol, with the CAS number 24449-39-6, is a synthetic organic compound characterized by its complex polycyclic structure, which includes two benzo[h]chromene units linked together. This compound features multiple methyl groups, contributing to its steric bulk and potentially influencing its solubility and reactivity. The presence of hydroxyl (-OH) groups indicates that it may exhibit phenolic properties, which can affect its hydrogen bonding capabilities and overall polarity. As a result, it may have applications in various fields, including materials science and organic synthesis. The compound's unique structure may also impart interesting optical properties, making it a candidate for studies in photochemistry or as a dye. However, detailed studies on its biological activity, stability, and specific applications would be necessary to fully understand its potential uses and behavior in different environments.

Formula: C₃₀H₂₆O₄

InChI: InChI=1/C30H26O4/c1-29(2)15-13-21-23(25(31)17-9-5-7-11-19(17)27(21)33-29)24-22-14-16-30(3,4)34-28(22)20-12-8-6-10-18(20)26(24)32/h5-16,31-32H,1-4H3

SMILES: CC1(C)C=Cc2c(c3c4C=CC(C)(C)Oc4c4ccccc4c3O)c(c3ccccc3c2O1)O

Synonyms:

• (5,5'-Bi-2H-naphtho(1,2-b)pyran)-6,6'-diol, 2,2,2',2'-tetramethyl-

Tectol

CAS: 24449-39-6

Tectol

Purity: ≥98%

Molecular weight: 450.52g/mol

Ref: 54-BUP00360

Tectol

CAS: 24449-39-6

Formula: C₃₀H₂₆O₄

Molecular weight: 450.53

Ref: 7W-GY3955

Tectol

CAS: 24449-39-6

Formula: C₃₀H₂₆O₄

Purity: 95%~99%

Molecular weight: 450.534

Ref: BP-BP4399

Tectol

CAS: 24449-39-6

Tectol: anti-plasmodial, IC50=3.44μM; combats leukemia in HL60/CEM cells; may trigger itchy dermatitis.

Formula: C₃₀H₂₆O₄

Purity: 99.23%

Color and Shape: Solid

Molecular weight: 450.52

Ref: TM-TN6512

Tectol

CAS: 24449-39-6

Tectol is an advanced synthetic formulation, designed as a high-efficiency chemical agent. It is sourced from meticulously controlled laboratory processes, ensuring maximum purity and consistency. With its unique chemical structure, Tectol acts through targeted molecular interactions that enhance stability and efficacy in diverse scientific applications.

Formula: C₃₀H₂₆O₄

Purity: Min. 95%

Molecular weight: 450.5 g/mol

Ref: 3D-ZAA44939