CAS 24457-21-4
:tert-Butyl 2-bromobutyrate
Description:
Tert-Butyl 2-bromobutyrate is an organic compound classified as an ester, specifically an alkyl bromide derivative of butyric acid. It features a tert-butyl group, which contributes to its branched structure, enhancing its steric hindrance and influencing its reactivity. The compound is characterized by the presence of a bromine atom at the second carbon of the butyric acid chain, which can participate in nucleophilic substitution reactions. Tert-Butyl 2-bromobutyrate is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents such as ether and chloroform, but less soluble in water due to its hydrophobic tert-butyl group. Its reactivity profile makes it useful in organic synthesis, particularly in the formation of carbon-carbon bonds and in various coupling reactions. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks if inhaled or ingested.
Formula:C8H15BrO2
InChI:InChI=1/C8H15BrO2/c1-5-6(9)7(10)11-8(2,3)4/h6H,5H2,1-4H3
SMILES:CCC(C(=O)OC(C)(C)C)Br
Synonyms:- 2-Bromobutyric acid tert-butyl ester
- Tert-Butyl 2-Bromobutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl 2-bromobutyrate
CAS:Formula:C8H15BrO2Purity:97%Color and Shape:LiquidMolecular weight:223.1075tert-Butyl 2-bromobutyrate
CAS:tert-Butyl 2-bromobutyratePurity:98%Color and Shape:LiquidMolecular weight:223.11g/moltert-Butyl 2-bromobutyrate
CAS:Versatile small molecule scaffoldFormula:C8H15BrO2Purity:Min. 95%Molecular weight:223.11 g/moltert-Butyl 2-bromobutyrate, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H15BrO2Purity:98%Molecular weight:223.12




