CAS 2446-84-6
:dimethyl (E)-diazene-1,2-dicarboxylate
Description:
Dimethyl (E)-diazene-1,2-dicarboxylate, with the CAS number 2446-84-6, is an organic compound characterized by its diazene functional group and two ester groups. It features a central diazene moiety, which consists of a nitrogen-nitrogen double bond, contributing to its reactivity. The presence of two carboxylate groups, each esterified with a methyl group, enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions. This compound is typically used in organic synthesis, particularly in the preparation of nitrogen-containing compounds and as a reagent in various chemical transformations. Its E configuration indicates the specific arrangement of substituents around the diazene bond, which can affect its chemical behavior and interactions. Dimethyl (E)-diazene-1,2-dicarboxylate is generally handled with care due to potential reactivity, and its properties make it a valuable intermediate in synthetic organic chemistry.
Formula:C4H6N2O4
InChI:InChI=1/C4H6N2O4/c1-9-3(7)5-6-4(8)10-2/h1-2H3/b6-5+
Synonyms:- 1,2-diazenedicarboxylic acid, dimethyl ester, (E)-
- Dimethyl (E)-diazene-1,2-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Azodicarboxylic acid dimethyl ester
CAS:Azodicarboxylic acid dimethyl esterPurity:95%Molecular weight:146.1g/molAzodicarboxylic acid dimethyl ester
CAS:Azodicarboxylic acid dimethyl ester (ADDE) is a metabolite of trifluoroacetic acid and is used as a reagent in organic synthesis. It has been shown to inhibit the action of x-ray crystal structures by forming hydrogen bonds with the hydroxyl group on the opposite side of the molecule. ADDE also inhibits congestive heart disease, coronary heart disease, and inflammatory diseases. ADDE may be used for treating infectious diseases such as malaria due to its ability to inhibit the growth of parasites by inhibiting protein synthesis.Formula:C4H6N2O4Color and Shape:Clear LiquidMolecular weight:146.1 g/molMethyl (NE)-N-methoxycarbonyliminocarbamate
CAS:Controlled ProductFormula:C4H6N2O4Color and Shape:NeatMolecular weight:146.101


