CAS 24464-63-9
:n-Decylboronic acid
Description:
n-Decylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a decyl alkyl chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic decyl chain. n-Decylboronic acid is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis, materials science, and as a building block in the development of boron-containing polymers. Additionally, it can serve as a reagent in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound's reactivity and functional properties make it valuable in medicinal chemistry and the development of boron-based drugs. Safety precautions should be taken when handling this substance, as with many organoboron compounds, due to potential toxicity and environmental concerns.
Formula:C10H23BO2
InChI:InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3
SMILES:CCCCCCCCCCB(O)O
Synonyms:- n-Decaneboronic acid
- Decylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Decylboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H23BO2Purity:98%Color and Shape:Powder, White to pale creamMolecular weight:186.10



