CAS 2447-70-3

methyl (15alpha,16xi,19E)-1-methyl-1,2-dihydro-2,17-epoxyakuammilan-16-carboxylate

Description:

Methyl (15alpha,16xi,19E)-1-methyl-1,2-dihydro-2,17-epoxyakuammilan-16-carboxylate, with the CAS number 2447-70-3, is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant genus of the Apocynaceae family. This compound features a complex structure characterized by a bicyclic framework, which includes an epoxy group and a carboxylate functional group. Its stereochemistry is significant, as indicated by the specific alpha and xi designations, which denote the spatial arrangement of atoms in the molecule. The presence of the methyl group contributes to its overall stability and reactivity. Methyl (15alpha,16xi,19E)-1-methyl-1,2-dihydro-2,17-epoxyakuammilan-16-carboxylate may exhibit biological activity, potentially influencing various physiological processes, although specific pharmacological properties would require further investigation. As with many alkaloids, it may have implications in medicinal chemistry, particularly in the development of therapeutic agents. Proper handling and safety measures should be observed due to the potential bioactivity of such compounds.

Formula: C₂₂H₂₆N₂O₃

InChI: InChI=1/C22H26N2O3/c1-4-14-12-24-10-9-21-15-7-5-6-8-17(15)23(2)22(21)18(24)11-16(14)20(21,13-27-22)19(25)26-3/h4-8,16,18H,9-13H2,1-3H3/b14-4-/t16-,18-,20?,21-,22?/m0/s1

SMILES: C/C=C\1/CN2CC[C@]34c5ccccc5N(C)C54[C@@H]2C[C@@H]1C3(CO5)C(=O)OC

Pseudoakuammigine

CAS: 2447-70-3

Pseudoakuammigine is a biochemical substance.

Formula: C₂₂H₂₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 366.45

Ref: TM-T20565

Pseudoakuammigine

CAS: 2447-70-3

Formula: C₂₂H₂₆N₂O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 366.461

Ref: BP-SBP02635

Pseudoakuammigine

CAS: 2447-70-3

Pseudoakuammigine is an indole alkaloid, which is a naturally occurring compound found in certain plants, notably those belonging to the Apocynaceae family. As an indole alkaloid, it is biosynthesized through the terpenoid indole pathway in plants, illustrating the complex interplay of secondary metabolic processes that these organisms employ for various ecological functions.

Formula: C₂₂H₂₆N₂O₃

Purity: Min. 95%

Molecular weight: 366.5 g/mol

Ref: 3D-CAA44770