CAS 24484-96-6

2-Pyridinamine, 4-chloro-5-nitro-

Description:

2-Pyridinamine, 4-chloro-5-nitro- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the second position, a chlorine atom at the fourth position, and a nitro group (-NO2) at the fifth position of the pyridine ring. These substituents contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in further chemical transformations. Additionally, the chlorine atom can influence the compound's solubility and biological activity. As with many nitro-substituted compounds, 2-Pyridinamine, 4-chloro-5-nitro- may exhibit specific toxicological properties, necessitating careful handling and assessment in laboratory settings. Overall, this compound's unique structural features make it a subject of interest in synthetic organic chemistry and medicinal research.

Formula: C₅H₄ClN₃O₂

InChI: InChI=1/C5H4ClN3O2/c6-3-1-5(7)8-2-4(3)9(10)11/h1-2H,(H2,7,8)

SMILES: c1c(c(c[nH]c1=N)N(=O)=O)Cl

Synonyms:

• 2-Amino-4-Chloro-5-Nitropyridine
• 4-Chloro-5-nitropyridin-2-amine

2-Pyridinamine, 4-chloro-5-nitro-

CAS: 24484-96-6

Formula: C₅H₄ClN₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 173.5572

Ref: IN-DA002OAK

2-Amino-4-chloro-5-nitropyridine

CAS: 24484-96-6

2-Amino-4-chloro-5-nitropyridine

Purity: 97%

Color and Shape: Powder

Molecular weight: 173.56g/mol

Ref: 54-OR16693

2-Amino-4-chloro-5-nitropyridine

Controlled Product

CAS: 24484-96-6

Applications 2-Amino-4-chloro-5-nitropyridine (cas# 24484-96-6) is a compound useful in organic synthesis.

Formula: C₅H₄ClN₃O₂

Color and Shape: Neat

Molecular weight: 173.56

Ref: TR-A603487

4-Chloro-5-nitropyridin-2-amine

CAS: 24484-96-6

Formula: C₅H₄ClN₃O₂

Purity: 96%

Color and Shape: Solid, Yellow powder

Molecular weight: 173.56

Ref: 10-F092374

2-Amino-4-chloro-5-nitropyridine

CAS: 24484-96-6

Formula: C₅H₄ClN₃O₂

Molecular weight: 173.56

Ref: ST-EA-CP-F20006