CAS 24484-98-8

4-chloropyridine-2,3-diamine

Description:

4-Chloropyridine-2,3-diamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two amino groups (-NH2) located at the 2 and 3 positions of the pyridine ring, along with a chlorine atom at the 4 position. Its molecular structure contributes to its potential reactivity and applications in various chemical processes. The presence of the amino groups makes it a basic compound, capable of forming salts with acids. Additionally, the chlorine substituent can influence its reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Safety data should be consulted for handling, as with many nitrogen-containing compounds, it may pose health risks if ingested or inhaled. Overall, 4-chloropyridine-2,3-diamine is a valuable intermediate in chemical synthesis due to its functional groups and structural properties.

Formula: C₅H₆ClN₃

InChI: InChI=1/C5H6ClN3/c6-3-1-2-9-5(8)4(3)7/h1-2H,7H2,(H2,8,9)

SMILES: c1c[nH]c(=N)c(c1Cl)N

Synonyms:

• 2,3-Pyridinediamine, 4-Chloro-

2,3-Pyridinediamine, 4-chloro-

CAS: 24484-98-8

Formula: C₅H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 143.5742

Ref: IN-DA002OAJ

2,3-Diamino-4-chloropyridine

CAS: 24484-98-8

2,3-Diamino-4-chloropyridine

Purity: 97%

Molecular weight: 143.57g/mol

Ref: 54-OR52182

4-Chloropyridine-2,3-diamine

CAS: 24484-98-8

Purity: 95%

Molecular weight: 143.574

Ref: FT-CAPOC13673

4-Chloropyridine-2,3-diamine

CAS: 24484-98-8

Formula: C₅H₆ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.57

Ref: 10-F236664

2,3-Diamino-4-chloropyridine

Controlled Product

CAS: 24484-98-8

Applications 2,3-Diamino-4-chloropyridine

Formula: C₅H₆ClN₃

Color and Shape: Neat

Molecular weight: 143.57

Ref: TR-D415090