CAS 245-08-9

5H-pyrido[3,2-b]indole

Description:

5H-pyrido[3,2-b]indole, with the CAS number 245-08-9, is a heterocyclic organic compound that features a fused bicyclic structure comprising a pyridine and an indole moiety. This compound is characterized by its nitrogen-containing ring system, which contributes to its unique chemical properties and potential biological activities. It typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can influence its solubility and reactivity. The presence of nitrogen atoms in the ring enhances its ability to participate in hydrogen bonding and coordination with metal ions. 5H-pyrido[3,2-b]indole has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antitumor and antimicrobial activities. Its synthesis often involves multi-step organic reactions, and it can be analyzed using various spectroscopic techniques such as NMR and mass spectrometry. Overall, this compound represents a significant area of study in the field of organic and medicinal chemistry, with ongoing research into its applications and mechanisms of action.

Formula: C₁₁H₈N₂

InChI: InChI=1/C11H8N2/c1-2-5-9-8(4-1)11-10(13-9)6-3-7-12-11/h1-7,13H

SMILES: c1ccc2c(c1)c1c(cccn1)[nH]2

Synonyms:

• 5H-Pyrido(3,2-b)indole

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

Formula: C₁₁H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1946

Ref: IN-DA002OCE

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

5H-Pyrido[3,2-b]indole inhibits Plasmodium falciparum and Trypanosoma cruzi, exhibits cytotoxicity toward L6 cells

Formula: C₁₁H₈N₂

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 168.2

Ref: TM-TN9381

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

5H-Pyrido[3,2-b]indole

Purity: 98%

Molecular weight: 168.19g/mol

Ref: 54-OR93771

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

Formula: C₁₁H₈N₂

Purity: >98.0%(HPLC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 168.20

Ref: 3B-P2274

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 168.19900512695312

Ref: 10-F543787

δ-Carboline

Controlled Product

CAS: 245-08-9

Applications δ-Carboline is a tricyclic product derived from cryptolepine that contains antibacterial properties.
References Mazu, T., et. al.: Eur. J. Med. Chem., 46, 2378 (2011)

Formula: C₁₁H₈N₂

Color and Shape: Neat

Molecular weight: 168.195

Ref: TR-C176595

5H-Pyrido[3,2-b]indole

CAS: 245-08-9

5H-Pyrido[3,2-b]indole is a synthetic compound that is used as a fluorescence probe. It has been shown to bind to the amine groups of proteins, such as those found in the adenosine receptor and protein kinase C. The protonation of 5H-pyrido[3,2-b]indole leads to an equilibrium between two tautomers, which have different resonance structures and different emission spectra. This means that 5H-pyrido[3,2-b]indole can be used to measure pH values because its fluorescence intensity increases with increasing acidity. Its fluorescence spectrum can also be transferred into other solvents by mixing with them.

Formula: C₁₁H₈N₂

Purity: Min. 95%

Molecular weight: 168.2 g/mol

Ref: 3D-AAA24508