CAS 2450-08-0
:methyl pyrimidine-4-carboxylate
Description:
Methyl pyrimidine-4-carboxylate, with the CAS number 2450-08-0, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features a carboxylate functional group (-COO-) attached to the fourth carbon of the pyrimidine ring, along with a methyl group (-CH3) at the first position. Methyl pyrimidine-4-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents and exhibits moderate stability under standard conditions. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Its reactivity is influenced by the presence of the carboxylate group, which can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Overall, methyl pyrimidine-4-carboxylate is a versatile compound with applications in organic synthesis.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-10-6(9)5-2-3-7-4-8-5/h2-4H,1H3
SMILES:COC(=O)c1ccncn1
Synonyms:- 4-Pyrimidinecarboxylic Acid, Methyl Ester
- Pyrimidine-4-carboxylicacidmethylester
- Methyl 4-pyrimidinecarboxylate
- Pyrimidine-4-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pyrimidinecarboxylic acid, methyl ester
CAS:Formula:C6H6N2O2Purity:97%Color and Shape:SolidMolecular weight:138.1240Methyl pyrimidine-4-carboxylate
CAS:Methyl pyrimidine-4-carboxylateFormula:C6H6N2O2Purity:≥95%Color and Shape: light orange solidMolecular weight:138.12g/molPyrimidine-4-carboxylic acid methyl ester
CAS:The pyrimidine-4-carboxylic acid methyl ester is a neutralized derivative of the natural amino acid pyrimidine-4-carboxylic acid. It can be metabolized in vivo to the active form, bleomycin. The neutralized form is useful for the synthesis of betaines and other compounds. This product is also used as an intermediate in the synthesis of metastable carbenes that are difficult to synthesize by other means. Pyrimidine-4-carboxylic acid methyl ester has been used as a reagent in mass spectrometry to identify isotopomers and isomers. It can also be used as a precursor for chemical transfer reactions with carbenes.Formula:C6H6N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:138.12 g/molMethyl Pyrimidine-4-carboxylate
CAS:Formula:C6H6N2O2Purity:98%Color and Shape:SolidMolecular weight:138.126



