CAS 24502-78-1
:Acetylshikonin
Description:
Acetylshikonin is a naturally occurring compound classified as a naphthoquinone derivative, primarily extracted from the roots of the plant Lithospermum erythrorhizon, commonly known as purple gromwell. This compound is characterized by its distinctive chemical structure, which includes a naphthalene ring system with various functional groups, contributing to its biological activity. Acetylshikonin exhibits a range of pharmacological properties, including anti-inflammatory, antimicrobial, and antioxidant activities, making it of interest in medicinal chemistry and natural product research. It is often studied for its potential therapeutic applications, particularly in wound healing and skin regeneration. The compound is typically soluble in organic solvents, and its stability can be influenced by factors such as pH and light exposure. Additionally, acetylshikonin's bioactivity is attributed to its ability to modulate various cellular pathways, which has prompted investigations into its mechanisms of action and potential uses in treating various diseases. Overall, acetylshikonin represents a significant compound in the field of natural products with promising applications in health and medicine.
Formula:C18H18O6
InChI:InChI=1S/C18H18O6/c1-9(2)4-7-15(24-10(3)19)11-8-14(22)16-12(20)5-6-13(21)17(16)18(11)23/h4-6,8,15,20-21H,7H2,1-3H3/t15-/m1/s1
InChI key:InChIKey=WNFXUXZJJKTDOZ-OAHLLOKOSA-N
SMILES:O=C1C=2C(C(=O)C=C1[C@@H](CC=C(C)C)OC(C)=O)=C(O)C=CC2O
Synonyms:- (1R)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl acetate
- (R)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl acetate
- 1,4-Naphthalenedione, 2-[(1R)-1-(acetyloxy)-4-methyl-3-penten-1-yl]-5,8-dihydroxy-
- 1,4-Naphthalenedione, 2-[(1R)-1-(acetyloxy)-4-methyl-3-pentenyl]-5,8-dihydroxy-
- 1,4-Naphthalenedione, 2-[1-(acetyloxy)-4-methyl-3-pentenyl]-5,8-dihydroxy-, (R)-
- 1,4-Naphthoquinone, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, 2-acetate, (+)-
- 1-(5,8-Dihydroxy-1,4-Dioxo-1,4-Dihydronaphthalen-2-Yl)-4-Methylpent-3-En-1-Yl Acetate
- 2-[(1R)-1-(Acetyloxy)-4-methyl-3-penten-1-yl]-5,8-dihydroxy-1,4-naphthalenedione
- Acetylshikonin
- NSC 110199
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1,4-Naphthalenedione, 2-[(1R)-1-(acetyloxy)-4-methyl-3-penten-1-yl]-5,8-dihydroxy-
CAS:Formula:C18H18O6Purity:98%Color and Shape:SolidMolecular weight:330.3319Acetylshikonin
CAS:Acetylshikonin, an AChE inhibitor and a non-selective cytochrome P450 inhibitor, is derived from Comfrey and has anticancer and anti-inflammatory properties.Formula:C18H18O6Purity:92.45% - 99.74%Color and Shape:SolidMolecular weight:330.33Ref: TM-T5S2343
1mg42.00€5mg88.00€10mg135.00€25mg255.00€50mg378.00€100mg560.00€500mg1,216.00€1mL*10mM (DMSO)88.00€Acetylshikonin
CAS:Controlled ProductApplications Acetylshikonin is the main ingredient of Zicao, which has used in clinics as a traditional Chinese for thousands of years. It exerts anti-obesity and anti-NAFLD effects through the regulation of lipid metabolism and anti-inflammatory effects. Also, it is a 1,4-naphthoquinone pigment extracted from the roots of Lithospermum erythrorhizon with anti-tumor effects.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Su, M., et al.: Mol., 21, 976/1-976/14 (2016); Koike, A., et al.: Biol. Pharm. Bull., 39, 969-976 (2016)Formula:C18H18O6Color and Shape:NeatMolecular weight:330.33Acetylshikonin
CAS:Acetylshikonin is a naphthoquinone derivative, which is a natural bioactive compound extracted from the roots of Lithospermum erythrorhizon and other Boraginaceae plants. Its mechanism of action involves multiple pathways, including the inhibition of topoisomerase, disruption of microtubule dynamics, and induction of apoptosis in cancer cells. These biochemical interactions lead to its potential as an anti-cancer agent.Formula:C18H18O6Purity:Min. 98 Area-%Color and Shape:Brown PowderMolecular weight:330.33 g/mol






