CymitQuimica logo

CAS 24503-25-1

:

ethyl 4-[(diaminomethylidene)amino]benzoate

Description:
Ethyl 4-[(diaminomethylidene)amino]benzoate, identified by its CAS number 24503-25-1, is an organic compound that features a benzoate structure with an ethyl ester group and a diaminomethylidene substituent. This compound typically exhibits characteristics common to aromatic amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of amino groups. The diaminomethylidene moiety can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile intermediate in organic synthesis. The presence of both an ester and amino groups suggests that it may have applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C10H13N3O2
InChI:InChI=1/C10H13N3O2/c1-2-15-9(14)7-3-5-8(6-4-7)13-10(11)12/h3-6H,2H2,1H3,(H4,11,12,13)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.