CymitQuimica logo

CAS 24503-62-6

:

3-chlorotetrafluoropropionyl chloride

Description:
3-Chlorotetrafluoropropionyl chloride, with the CAS number 24503-62-6, is a chemical compound characterized by its unique structure that includes a chlorinated propionyl group and four fluorine atoms attached to the carbon backbone. This compound is typically a colorless to pale yellow liquid, exhibiting a pungent odor. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent electrophile in various chemical reactions. The fluorine atoms contribute to its high electronegativity and can enhance its stability and lipophilicity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 3-chlorotetrafluoropropionyl chloride may pose health hazards, including corrosive effects on skin and respiratory irritation, necessitating careful handling and appropriate safety measures in laboratory settings. Its applications often leverage its reactivity in forming various derivatives and compounds in synthetic organic chemistry.
Formula:C3Cl2F4O
InChI:InChI=1/C3Cl2F4O/c4-1(10)2(6,7)3(5,8)9
SMILES:C(=O)(C(C(Cl)(F)F)(F)F)Cl
Synonyms:
  • 3-Chloro-2,2,3,3-Tetrafluoropropanoyl Chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.