CAS 24507-29-7
:3-Bromo-4-ethoxybenzoic acid
Description:
3-Bromo-4-ethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and an ethoxy group attached to a benzoic acid framework. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the ethoxy group is positioned at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic ethoxy group. The presence of both the bromine and ethoxy groups can influence its reactivity, making it useful in various organic synthesis applications, including the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as with many halogenated compounds, due to potential toxicity and environmental concerns.
Formula:C9H9BrO3
InChI:InChI=1/C9H9BrO3/c1-2-13-8-4-3-6(9(11)12)5-7(8)10/h3-5H,2H2,1H3,(H,11,12)
SMILES:CCOc1ccc(cc1Br)C(=O)O
Synonyms:- Benzoic Acid, 3-Bromo-4-Ethoxy-
- 3-Bromo-4-ethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 3-bromo-4-ethoxy-
CAS:Formula:C9H9BrO3Purity:95%Color and Shape:SolidMolecular weight:245.07003-Bromo-4-ethoxybenzoic acid
CAS:3-Bromo-4-ethoxybenzoic acid is an organic compound that has been shown to have biological activity against pathogens. 3-Bromo-4-ethoxybenzoic acid inhibits the growth of bacteria by binding to the enzyme chloride channel and regulating its function. It also has a regulatory effect on chloride channels and can be used as a catalyst for many reactions in organic synthesis.Formula:C9H9BrO3Purity:Min. 95%Molecular weight:245.07 g/mol3-bromo-4-ethoxybenzoic acid
CAS:Formula:C9H9BrO3Purity:97%Color and Shape:SolidMolecular weight:245.072



