CAS 2451-91-4
:dibenzylcyanamide
Description:
Dibenzylcyanamide is an organic compound characterized by its structure, which features two benzyl groups attached to a cyanamide functional group. It is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar organic solvents such as ethanol and acetone, while being less soluble in non-polar solvents. The compound has a molecular formula of C16H16N2 and a relatively low molecular weight. Dibenzylcyanamide is known for its applications in the synthesis of various pharmaceuticals and agrochemicals, often serving as an intermediate in chemical reactions. It possesses a range of chemical properties, including the ability to participate in nucleophilic reactions due to the presence of the cyanamide group. Additionally, dibenzylcyanamide can exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C15H14N2
InChI:InChI=1/C15H14N2/c16-13-17(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10H,11-12H2
SMILES:c1ccc(cc1)CN(Cc1ccccc1)C#N
Synonyms:- cyanamide, N,N-bis(phenylmethyl)-
- Dibenzylcyanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyanamide, N,N-bis(phenylmethyl)-
CAS:Formula:C15H14N2Purity:97%Color and Shape:SolidMolecular weight:222.2851Dibenzylcyanamide
CAS:Formula:C15H14N2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:222.29Cyanodibenzylamine
CAS:Cyanodibenzylamine is a synthetic, pharmaceutical preparation. It is an amine that undergoes nucleophilic attack by an amide to form a cyanoguanidine. Cyanodibenzylamine can be used as a stabilizer and additive in pharmaceutical preparations. It also has the ability to bind metal hydroxides, which may be due to the presence of basic fibroblast growth factor and isoquinoline compound. Cyanodibenzylamine is also used as a polymerization initiator in organic chemistry, with hydrocarbon solvents such as benzene or toluene as its solvent.
Formula:C15H14N2Purity:Min. 95%Color and Shape:PowderMolecular weight:222.29 g/molRef: 3D-FC67317
Discontinued product




