CAS 24519-27-5: 5,6-Dihydro-1,4-dithiin-2,3-dicarbonitrile

Description:5,6-Dihydro-1,4-dithiin-2,3-dicarbonitrile is a heterocyclic compound characterized by its unique structure, which includes a dithiolane ring and two cyano groups. This compound features a six-membered ring containing two sulfur atoms and is known for its potential applications in organic synthesis and materials science. The presence of cyano groups contributes to its reactivity, making it a useful intermediate in various chemical reactions. The compound is typically a solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its chemical properties, such as stability and reactivity, can be influenced by the presence of the sulfur atoms and the cyano groups, which can participate in nucleophilic and electrophilic reactions. Additionally, 5,6-Dihydro-1,4-dithiin-2,3-dicarbonitrile may have interesting electronic properties due to its conjugated system, which can be explored in the context of organic electronics or as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance.

Formula:C₆H₄N₂S₂

InChI:InChI=1S/C6H4N2S2/c7-3-5-6(4-8)10-2-1-9-5/h1-2H2

InChI key:InChIKey=FBSVHCGELQWERO-UHFFFAOYSA-N

SMILES:N#CC=1SCCSC1C#N