CAS 2452-25-7
:5-Methoxy-3-indoleacetamide
Description:
5-Methoxy-3-indoleacetamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a methoxy group (-OCH3) and an acetamide group (-C(=O)NH2) attached to the indole framework, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, which may include effects on neurotransmitter systems or other physiological processes. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in pharmacology. As with many indole derivatives, it may exhibit a range of activities, including anti-inflammatory or neuroprotective effects, although specific biological data would depend on empirical studies. Proper handling and safety measures should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-15-8-2-3-10-9(5-8)7(6-13-10)4-11(12)14/h2-3,5-6,13H,4H2,1H3,(H2,12,14)
SMILES:COc1ccc2c(c1)c(CC(=N)O)c[nH]2
Synonyms:- 2-(5-methoxy-1H-indol-3-yl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Methoxyindole-3-acetamide
CAS:Please enquire for more information about 5-Methoxyindole-3-acetamide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C11H12N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:204.23 g/mol5-Methoxyindole-3-acetamide
CAS:Controlled ProductFormula:C11H12N2O2Color and Shape:NeatMolecular weight:204.2255-Methoxyindole-3-acetamide
CAS:5-Methoxyindole-3-acetamide is a chemical compound that can be used as a reaction component, reagent, and useful scaffold. It is also a high quality research chemical and speciality chemical. 5-Methoxyindole-3-acetamide has been shown to be a versatile building block with utility in the synthesis of complex compounds. This compound has been shown to act as an intermediate in the synthesis of fine chemicals such as pharmaceuticals, pesticides, and herbicides.
Formula:C11H12N2O2Purity:Min. 98.0 Area-%Molecular weight:204.23 g/mol



