CAS 24539-60-4: 1-Decyl 1,2-benzenedicarboxylate
Description:1-Decyl 1,2-benzenedicarboxylate, with the CAS number 24539-60-4, is an organic compound characterized by its structure, which includes a decyl chain and two carboxylate groups attached to a benzene ring. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is generally insoluble in water but soluble in organic solvents, which is common for larger alkyl esters. The presence of the decyl group contributes to its hydrophobic characteristics, while the dicarboxylate functionality can impart some degree of polarity. This compound may be used in various applications, including as a plasticizer, in coatings, or in the formulation of surfactants. Its stability and reactivity can vary depending on environmental conditions, such as temperature and pH. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C18H26O4
InChI:InChI=1S/C18H26O4/c1-2-3-4-5-6-7-8-11-14-22-18(21)16-13-10-9-12-15(16)17(19)20/h9-10,12-13H,2-8,11,14H2,1H3,(H,19,20)
InChI key:InChIKey=FEFCILUKYGHITK-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC=CC1C(=O)OCCCCCCCCCC
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 1-decyl ester
- 1,2-Benzenedicarboxylic acid, monodecyl ester
- 1-Decyl 1,2-benzenedicarboxylate
- 2-[(Decyloxy)Carbonyl]Benzoic Acid
- Monodecyl phthalate
- Phthalic acid, monodecyl ester
- Decyl hydrogen phthalate
