CAS 2454-72-0
:4-hydroxy-5-methoxy-2-nitrobenzaldehyde
Description:
4-Hydroxy-5-methoxy-2-nitrobenzaldehyde, with the CAS number 2454-72-0, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group along with hydroxyl, methoxy, and nitro substituents. This compound typically appears as a yellow to orange crystalline solid and is soluble in organic solvents. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, while the methoxy (-OCH3) group can influence its electronic properties and reactivity. The nitro (-NO2) group is known for its electron-withdrawing effects, which can enhance the electrophilicity of the aromatic ring. This compound may be utilized in various chemical syntheses and research applications, particularly in the fields of organic chemistry and materials science. Its unique combination of functional groups allows for diverse reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound due to the presence of the nitro group, which can pose health risks.
Formula:C8H7NO5
InChI:InChI=1/C8H7NO5/c1-14-8-2-5(4-10)6(9(12)13)3-7(8)11/h2-4,11H,1H3
SMILES:COc1cc(C=O)c(cc1O)N(=O)=O
Synonyms:- Benzaldehyde, 4-Hydroxy-5-Methoxy-2-Nitro-
- 4-Hydroxy-5-methoxy-2-nitrobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzaldehyde, 4-hydroxy-5-methoxy-2-nitro-
CAS:Formula:C8H7NO5Purity:98%Color and Shape:SolidMolecular weight:197.1449Ref: IN-DA002OHT
1g119.00€5g289.00€10g697.00€25gTo inquire50gTo inquire100gTo inquire100mg43.00€250mg54.00€4-Hydroxy-5-methoxy-2-nitrobenzaldehyde
CAS:4-Hydroxy-5-methoxy-2-nitrobenzaldehydePurity:97%Molecular weight:197.14g/mol4-hydroxy-5-methoxy-2-nitrobenzaldehyde
CAS:4-Hydroxy-5-methoxy-2-nitrobenzaldehyde (4HMN) is a proton donor that can be used as a crosslinking agent. It is an acidic compound that binds to the substrate, usually via hydrogen bonds. 4HMN has been shown to have good binding affinity for tumour cell lines and can be used as a crosslinking agent in bioconjugation reactions. It is also a reversible chemical reaction, which means it can be hydrolyzed under certain conditions. 4HMN has been shown to be capable of enhancing the rate of enzymatic reactions by acting as a cofactor or coenzyme, such as degradable enzymes and enzymes with low turnover rates. The kinetic process of these reactions are measured by fluorescence techniques and gel permeation chromatography.Formula:C8H7NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:197.1 g/mol





