CAS 24542-66-3

2-[(2-Methoxy-5-methylphenyl)amino]benzoic acid

Description:

2-[(2-Methoxy-5-methylphenyl)amino]benzoic acid, with the CAS number 24542-66-3, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and an amino group attached to a substituted phenyl ring. This compound features a methoxy group and a methyl group on the phenyl ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both the amino and carboxylic acid functional groups suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, given its structural features that allow for further functionalization. Additionally, its potential biological activity could be explored in medicinal chemistry, although specific biological properties would require further investigation.

Formula: C₁₅H₁₅NO₃

InChI: InChI=1S/C15H15NO3/c1-10-7-8-14(19-2)13(9-10)16-12-6-4-3-5-11(12)15(17)18/h3-9,16H,1-2H3,(H,17,18)

InChI key: InChIKey=UTBUACJZUUHBJE-UHFFFAOYSA-N

SMILES: N(C1=C(C(O)=O)C=CC=C1)C2=C(OC)C=CC(C)=C2

Synonyms:

• Benzoic acid, 2-[(2-methoxy-5-methylphenyl)amino]-
• Anthranilic acid, N-(6-methoxy-m-tolyl)-
• 2-[(2-Methoxy-5-methylphenyl)amino]benzoic acid

2-((2-Methoxy-5-methylphenyl)amino)benzoic acid

CAS: 24542-66-3

Versatile small molecule scaffold

Formula: C₁₅H₁₅NO₃

Purity: Min. 95%

Molecular weight: 257.28 g/mol

Ref: 3D-ZAA54266