CAS 245439-36-5

4-(3-Bromophenyl)tetrahydropyran-4-carbonitrile

Description:

4-(3-Bromophenyl)tetrahydropyran-4-carbonitrile is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and a bromophenyl group. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis. The carbonitrile functional group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions or cycloadditions. This compound is typically used in medicinal chemistry and material science due to its potential biological activity and ability to serve as a building block for more complex molecules. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications. Additionally, safety precautions should be taken when handling this compound, as brominated compounds can pose health risks. Overall, 4-(3-Bromophenyl)tetrahydropyran-4-carbonitrile is a versatile compound with significant implications in chemical research and development.

Formula: C₁₂H₁₂BrNO

InChI: InChI=1S/C12H12BrNO/c13-11-3-1-2-10(8-11)12(9-14)4-6-15-7-5-12/h1-3,8H,4-7H2

SMILES: c1cc(cc(c1)Br)C1(CCOCC1)C#N

4-(3-Bromophenyl)tetrahydro-2H-pyran-4-carbonitrile

CAS: 245439-36-5

Formula: C₁₂H₁₂BrNO

Molecular weight: 266.1338

Ref: IN-DA002OH7

4-(3-Bromophenyl)oxane-4-carbonitrile

CAS: 245439-36-5

Purity: 95.0%

Color and Shape: Solid, Yellow solid

Molecular weight: 266.13800048828125

Ref: 10-F214459

4-(3-Bromophenyl)oxane-4-carbonitrile

CAS: 245439-36-5

Versatile small molecule scaffold

Formula: C₁₂H₁₂BrNO

Purity: Min. 95%

Molecular weight: 266.14 g/mol

Ref: 3D-VJA43936