CAS 2455-92-7
:sulclamide
Description:
Sulclamide, with the CAS number 2455-92-7, is a chemical compound that belongs to the class of sulfonamides. It is characterized by the presence of a sulfonamide functional group, which typically consists of a sulfur atom bonded to an oxygen atom and a nitrogen atom. This compound is known for its potential applications in medicinal chemistry, particularly as an antibacterial agent. Sulclamide exhibits properties such as moderate solubility in water and stability under standard conditions. Its structure may influence its biological activity, making it a subject of interest in pharmaceutical research. Additionally, like many sulfonamides, it may interact with various biological systems, which can lead to both therapeutic effects and potential side effects. Safety and handling precautions are essential when working with sulclamide, as with any chemical substance, to mitigate risks associated with exposure. Overall, sulclamide represents a notable example of sulfonamide chemistry with implications in health and disease management.
Formula:C7H7ClN2O3S
InChI:InChI=1/C7H7ClN2O3S/c8-5-2-1-4(7(9)11)3-6(5)14(10,12)13/h1-3H,(H2,9,11)(H2,10,12,13)
SMILES:c1cc(c(cc1C(=N)O)S(=O)(=O)N)Cl
Synonyms:- Sulclamide [INN:DCF]
- 4-Chlor-3-sulfamoylbenzamid
- 4-Chloro-3-sulfamoylbenzamide
- Sd 141-12
- Sulclamid
- Sulclamida
- Sulclamidum
- Unii-7Ghi2O527Q
- Sulclamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Indapamide Impurity 2
CAS:Formula:C7H7ClN2O3SColor and Shape:White To Off-White SolidMolecular weight:234.65Sulclamide
CAS:Sulclamide, a sulfamoylbenzoic acid derivative, exhibits diuretic activity and functions as an inhibitor of carbonic anhydrase [1].Formula:C7H7ClN2O3SColor and Shape:SolidMolecular weight:234.66




