CAS 24556-15-8: propyl tricyclo[3.3.1.1~3,7~]decane-1-carboxylate
Description:Propyl tricyclo[3.3.1.1^3,7]decane-1-carboxylate, with the CAS number 24556-15-8, is an organic compound characterized by its unique tricyclic structure. This compound features a carboxylate functional group, which contributes to its reactivity and solubility properties. The presence of the propyl group indicates that it is an ester, which typically enhances its volatility and potential for use as a solvent or in organic synthesis. The tricyclic framework provides rigidity and stability, influencing its physical properties such as melting and boiling points. Additionally, the compound's stereochemistry can affect its interactions with biological systems, making it of interest in medicinal chemistry. Its specific applications may vary, but compounds with similar structures are often explored for their potential in pharmaceuticals, agrochemicals, and materials science. Overall, propyl tricyclo[3.3.1.1^3,7]decane-1-carboxylate exemplifies the complexity and diversity of organic compounds, showcasing the interplay between structure and function in chemical substances.
Formula:C14H22O2
InChI:InChI=1/C14H22O2/c1-2-3-16-13(15)14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,2-9H2,1H3
- Synonyms:
- Propyl 1-Adamantanecarboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, propyl ester REF: IN-DA002OJSCAS: 24556-15-8 | - - - | To inquire | Tue 12 Aug 25 |
![]() | Propyl adamantane-1-carboxylate REF: 3D-FP123131CAS: 24556-15-8 | Min. 95% | - - - | Discontinued product |

Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, propyl ester
Ref: IN-DA002OJS
Undefined size | To inquire |

Propyl adamantane-1-carboxylate
Ref: 3D-FP123131
10g | Discontinued | Request information |