
CAS 24566-82-3
:1-Decanamine, 10-bromo-, hydrobromide (1:1)
Description:
1-Decanamine, 10-bromo-, hydrobromide (1:1) is an organic compound characterized by its long aliphatic chain and the presence of a bromine atom at the 10th position of the decanamine structure. This compound features a primary amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The hydrobromide salt form indicates that the amine is protonated, enhancing its solubility in polar solvents, particularly water. The presence of the bromine atom can also impart unique properties, such as increased reactivity and potential applications in organic synthesis or as a building block in pharmaceuticals. Additionally, the long hydrocarbon chain may influence the compound's hydrophobic characteristics, affecting its interaction with biological membranes and its overall bioactivity. Overall, 1-Decanamine, 10-bromo-, hydrobromide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C10H22BrN·BrH
InChI:InChI=1S/C10H22BrN.BrH/c11-9-7-5-3-1-2-4-6-8-10-12;/h1-10,12H2;1H
InChI key:InChIKey=ZWGBEXOWJAAGPB-UHFFFAOYSA-N
SMILES:C(CCCCCN)CCCCBr.Br
Synonyms:- Decylamine, 10-bromo-, hydrobromide
- 1-Decanamine, 10-bromo-, hydrobromide (1:1)
- 10-Bromo-1-aminodecane Hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
10-Bromo-1-aminodecane, Hydrobromide
CAS:Formula:C10H23Br2NColor and Shape:SolidMolecular weight:317.104310-Bromo-1-aminodecane, Hydrobromide
CAS:Controlled ProductApplications 10-Bromo-1-aminodecane, Hydrobromide (cas# 24566-82-3) is a compound useful in organic synthesis.
Formula:C10H22BrN·BrHColor and Shape:NeatMolecular weight:317.10

