CymitQuimica logo

CAS 24567-97-3

:

[4-(2-amino-1-bromo-2-oxoethyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxidanyl

Description:
The chemical substance with the name "[4-(2-amino-1-bromo-2-oxoethyl)-2,2,6,6-tetramethylpiperidin-1-yl]oxidanyl" and CAS number "24567-97-3" is a complex organic compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, substituted with multiple alkyl groups that enhance its steric bulk and lipophilicity. The presence of an amino group and a bromo substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The oxoethyl group contributes to the compound's overall polarity and may influence its solubility in various solvents. This compound may exhibit biological activity due to its structural motifs, making it of interest in medicinal chemistry. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reactive species. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields, including pharmaceuticals and materials science.
Formula:C11H20BrN2O2
InChI:InChI=1/C11H20BrN2O2/c1-10(2)5-7(8(12)9(13)15)6-11(3,4)14(10)16/h7-8H,5-6H2,1-4H3,(H2,13,15)
SMILES:CC1(C)CC(CC(C)(C)N1O)C(C(=N)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.