CymitQuimica logo

CAS 245679-18-9

:

1,3-Bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazolium tetrafluoroborate

Description:
1,3-Bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazolium tetrafluoroborate is an ionic liquid characterized by its unique imidazolium cation and tetrafluoroborate anion. This compound typically exhibits low volatility, high thermal stability, and good solubility in various organic solvents, making it suitable for a range of applications in organic synthesis and catalysis. The presence of bulky trimethylphenyl groups contributes to its steric hindrance, which can influence its reactivity and solvation properties. Additionally, the tetrafluoroborate anion is known for its ability to stabilize the cation, enhancing the ionic liquid's overall stability. This substance is often utilized in electrochemical applications, as well as in the development of advanced materials due to its favorable properties. Its unique structure and characteristics make it a subject of interest in both academic and industrial research, particularly in the fields of green chemistry and sustainable processes.
Formula:C21H27BF4N2
InChI:InChI=1/C21H27N2.BF4/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;2-1(3,4)5/h9-13H,7-8H2,1-6H3;/q+1;-1
InChI key:VNRDQIOMNLIVQJ-UHFFFAOYSA-N
SMILES:[B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C
Synonyms:
  • 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-1H-imidazol-3-ium
  • 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydro-1H-imidazol-3-ium tetrafluoroborate
Found 7 products.