CAS 24569-83-3
:Glycine, N-methyl-N-(phosphonomethyl)-
Description:
Glycine, N-methyl-N-(phosphonomethyl)-, also known as glyphosate, is a phosphonic acid derivative characterized by its amino acid structure. It features a glycine backbone with a methyl group and a phosphonomethyl group attached to the nitrogen atom. This compound is a white crystalline solid that is soluble in water, making it suitable for various applications, particularly in agriculture as a herbicide. Its mechanism of action involves inhibiting a specific enzyme pathway (the shikimic acid pathway) that is essential for the growth of plants and some microorganisms, which makes it effective in controlling a wide range of weeds. Additionally, glyphosate is known for its low toxicity to humans and animals when used as directed, although concerns regarding its environmental impact and potential health effects have been subjects of extensive research and debate. The compound is typically used in formulations that enhance its stability and efficacy in agricultural practices.
Formula:C4H10NO5P
InChI:InChI=1S/C4H10NO5P/c1-5(2-4(6)7)3-11(8,9)10/h2-3H2,1H3,(H,6,7)(H2,8,9,10)
InChI key:SGVDYFNFBJGOHB-UHFFFAOYSA-N
SMILES:CN(CC(=O)O)CP(=O)(O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(Methyl(phosphonomethyl)amino)acetic acid
CAS:2-(Methyl(phosphonomethyl)amino)acetic acidFormula:C4H10NO5PPurity:95%Molecular weight:183.12-(Methyl(phosphonomethyl)amino)acetic acid
CAS:Formula:C4H10NO5PPurity:95%Color and Shape:SolidMolecular weight:183.0997Methyl glyphosate
CAS:C-Methyl glyphosate is a herbicide that inhibits the growth of plants by interfering with the production of certain amino acids. It acts as an inhibitor of the enzyme 5-enolpyruvylshikimate-3-phosphate synthase (EPSPS), which catalyzes the conversion of shikimate-3-phosphate and phosphoenolpyruvate to 5-enolpyruvylshikimate-3-phosphate. C-Methyl glyphosate has been shown to be toxic to humans and animals, but not plants. The mechanism for this toxicity is unknown, but it may be due to its ability to inhibit calcium ion influx into cells or its ability to bind covalently with cellular macromolecules.Formula:C4H10NO5PPurity:Min. 95%Color and Shape:PowderMolecular weight:183.1 g/mol







