CAS 2457-48-9

3,4,5-Tribromo-pyridine

Description:

3,4,5-Tribromo-pyridine is a halogenated aromatic compound characterized by the presence of three bromine atoms attached to a pyridine ring, specifically at the 3, 4, and 5 positions. Its molecular formula is C5H2Br3N, and it features a nitrogen atom in the heterocyclic pyridine structure, contributing to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as a distinct color and odor, which can vary based on purity and environmental conditions. 3,4,5-Tribromo-pyridine is known for its applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, due to the halogen substituents, it may exhibit increased lipophilicity and potential biological activity, warranting further investigation in medicinal chemistry. Safety precautions should be observed when handling this compound, as brominated compounds can pose health and environmental risks.

Formula: C₅H₂Br₃N

InChI: InChI=1/C5H2Br3N/c6-3-1-9-2-4(7)5(3)8/h1-2H

SMILES: c1c(c(c(cn1)Br)Br)Br

Synonyms:

• 3,4,5-Tribromopyridine

Pyridine, 3,4,5-tribromo-

CAS: 2457-48-9

Formula: C₅H₂Br₃N

Purity: 98%

Color and Shape: Solid

Molecular weight: 315.7881

Ref: IN-DA002OLU

3,4,5-Tribromopyridine

CAS: 2457-48-9

3,4,5-Tribromopyridine

Purity: 98%

Molecular weight: 315.79g/mol

Ref: 54-OR42114

3,4,5-Tribromopyridine

CAS: 2457-48-9

Formula: C₅H₂Br₃N

Purity: >98.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 315.79

Ref: 3B-T3248

3,4,5-Tribromopyridine

CAS: 2457-48-9

Formula: C₅H₂Br₃N

Purity: 98%+(LC-MS);RG

Color and Shape: Solid, Whitish crystalline powder

Molecular weight: 315.79

Ref: 10-F050425