
CAS 2457-81-0
:2-[(1,3-Dihydro-1,3-dioxo-2H-inden-2-ylidene)amino]-1H-indene-1,3(2H)-dione
Description:
The chemical substance known as 2-[(1,3-Dihydro-1,3-dioxo-2H-inden-2-ylidene)amino]-1H-indene-1,3(2H)-dione, with the CAS number 2457-81-0, is a synthetic organic compound characterized by its complex structure, which includes an indene core and a dioxo group. This compound typically exhibits properties associated with diketones and can participate in various chemical reactions due to the presence of both carbonyl and amino functional groups. It is often studied for its potential applications in pharmaceuticals and organic synthesis, particularly in the development of dyes and pigments. The presence of multiple functional groups suggests that it may exhibit interesting reactivity and biological activity. Additionally, its molecular structure may confer specific optical properties, making it a candidate for research in materials science. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C18H9NO4
InChI:InChI=1S/C18H9NO4/c20-15-9-5-1-2-6-10(9)16(21)13(15)19-14-17(22)11-7-3-4-8-12(11)18(14)23/h1-8,13H
InChI key:InChIKey=FVOWBCMQMVMPSF-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C1N=C3C(=O)C=4C(C3=O)=CC=CC4)=CC=CC2
Synonyms:- 1H-Indene-1,3(2H)-dione, 2-[(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)amino]-
- 2-[(1,3-Dihydro-1,3-dioxo-2H-inden-2-ylidene)amino]-1H-indene-1,3(2H)-dione
- 1,3-Indandione, 2,2′-nitrilodi-
- Protonated Ruhemann's purple
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
